| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:30 UTC |
|---|
| Update Date | 2025-03-21 18:06:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00061010 |
|---|
| Frequency | 51.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10O5 |
|---|
| Molecular Mass | 258.0528 |
|---|
| SMILES | COc1cc2c(c3oc(=O)ccc13)C1C=COC1O2 |
|---|
| InChI Key | FCTISVHCHRJHCZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | furanocoumarins |
|---|
| Direct Parent | angular furanocoumarins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransacetalsalkyl aryl ethersanisolescoumaransdihydrofuransheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | phenol etherether1-benzopyranalkyl aryl etherlactoneorganic oxideacetalaromatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundcoumarandihydrofuranbenzopyranheteroaromatic compoundangular furanocoumarinoxacycleorganic oxygen compoundpyrananisolehydrocarbon derivativebenzenoidorganooxygen compound |
|---|