| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:30 UTC |
|---|
| Update Date | 2025-03-21 18:06:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00061027 |
|---|
| Frequency | 51.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N5S+ |
|---|
| Molecular Mass | 222.0808 |
|---|
| SMILES | Cc1ncc(C[n+]2csnc2C)c(N)n1 |
|---|
| InChI Key | YTFLVBYLFUJUAX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic cationsorganopnictogen compoundsprimary aminesthiadiazoles |
|---|
| Substituents | aromatic heteromonocyclic compoundazacycleheteroaromatic compoundthiadiazolepyrimidineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic cationimidolactamamineazole |
|---|
