| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:33 UTC |
|---|
| Update Date | 2025-03-21 18:06:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00061127 |
|---|
| Frequency | 51.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H8O8P2 |
|---|
| Molecular Mass | 233.9694 |
|---|
| SMILES | O=P(O)(O)OCC1COP(=O)(O)O1 |
|---|
| InChI Key | WGGVTLZCJNGCQE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | dioxaphospholaneshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | 1,3_dioxaphospholaneoxacycleorganic oxideorganic oxygen compoundmonoalkyl phosphatealiphatic heteromonocyclic compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
