| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:33 UTC |
|---|
| Update Date | 2025-03-21 18:06:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00061143 |
|---|
| Frequency | 51.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H9O7P |
|---|
| Molecular Mass | 212.0086 |
|---|
| SMILES | O=C(O)CC(CP(=O)(O)O)C(=O)O |
|---|
| InChI Key | XOQVDBCNWPUEPS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | dicarboxylic acids and derivatives |
|---|
| Direct Parent | dicarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsfatty acids and conjugateshydrocarbon derivativesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidfatty acidorganic oxideorganic oxygen compounddicarboxylic acid or derivativesorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeorganophosphonic acid derivativeorganooxygen compound |
|---|
