| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:37 UTC |
|---|
| Update Date | 2025-03-21 18:06:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00061286 |
|---|
| Frequency | 50.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19N3O5S |
|---|
| Molecular Mass | 341.1045 |
|---|
| SMILES | CC(=O)OC1NS(=O)(=O)c2ccccc2N(CCN(C)C)C1=O |
|---|
| InChI Key | ASEIUUIDYRPQOK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acid estershydrocarbon derivativeslactamsmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsorganosulfonamidestertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl grouplactamorganosulfonic acid amideorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundtertiary amineorganoheterocyclic compoundazacycletertiary aliphatic aminecarboxamide groupmonocarboxylic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivativescarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|