| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:38 UTC |
|---|
| Update Date | 2025-03-21 18:06:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00061352 |
|---|
| Frequency | 50.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O5 |
|---|
| Molecular Mass | 260.0685 |
|---|
| SMILES | COc1cc(C(=O)O)ccc1Oc1ccc(O)cc1 |
|---|
| InChI Key | DXZCSXFPLBFPAA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzoic acidsbenzoyl derivativescarboxylic acidsdiarylethershydrocarbon derivativesm-methoxybenzoic acids and derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesphenoxy compounds |
|---|
| Substituents | diaryl etherphenol etherethercarboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidalkyl aryl ethercarboxylic acid derivativeorganic oxidebenzoic acidm-methoxybenzoic acid or derivativesbenzoic acid or derivativesmethoxybenzenearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundanisolephenolhydrocarbon derivativephenoxy compounddiphenyletherorganooxygen compound |
|---|
