| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:41 UTC |
|---|
| Update Date | 2025-03-21 18:06:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00061444 |
|---|
| Frequency | 50.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H24O7 |
|---|
| Molecular Mass | 340.1522 |
|---|
| SMILES | O=C(CCC(O)Cc1ccccc1)OC1CC(O)C(O)C(O)C1O |
|---|
| InChI Key | BORFNFOPUQUKLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativescarbonyl compoundscarboxylic acid esterscyclitols and derivativesfatty acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcyclohexanolcyclitol or derivativescyclic alcoholcarboxylic acid derivativearomatic homomonocyclic compoundfatty acid esterorganic oxidemonocarboxylic acid or derivativescarboxylic acid esterhydrocarbon derivativebenzenoid |
|---|