| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:59:41 UTC |
|---|
| Update Date | 2025-03-21 18:06:09 UTC |
|---|
| HMDB ID | HMDB0304124 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00061453 |
|---|
| Name | 3-deoxy-D-arabino-heptulosonate-7-phosphate |
|---|
| Frequency | 50.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13O10P |
|---|
| Molecular Mass | 288.0246 |
|---|
| SMILES | O=C(O)C(=O)CC(O)C(O)C(O)COP(=O)(O)O |
|---|
| InChI Key | PJWIPEXIFFQAQZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | medium-chain keto acids and derivatives |
|---|
| Direct Parent | medium-chain keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativesbeta-hydroxy ketonescarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholbeta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupcarboxylic acidmonosaccharidealpha-hydroxy ketonecarboxylic acid derivativeketonesaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatealpha-keto acidsecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganooxygen compoundmedium-chain keto acid |
|---|
