| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:41 UTC |
|---|
| Update Date | 2025-03-21 18:06:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00061461 |
|---|
| Frequency | 50.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17NO7 |
|---|
| Molecular Mass | 275.1005 |
|---|
| SMILES | O=C(O)C1CCN(C2OC(CO)C(O)C2O)C(=O)C1 |
|---|
| InChI Key | GJUDWLBJVKNVAD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | piperidinecarboxylic acids and derivatives |
|---|
| Direct Parent | piperidinecarboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidsdelta lactamshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspiperidinonesprimary alcoholssecondary alcoholstertiary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl grouplactamcarboxylic acidmonosaccharidecarboxylic acid derivativesaccharideorganic oxidetertiary carboxylic acid amidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinonepiperidinecarboxylic acidprimary alcoholalcoholazacycletetrahydrofurancarboxamide groupdelta-lactamoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|