| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:46 UTC |
|---|
| Update Date | 2025-03-21 18:06:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00061669 |
|---|
| Frequency | 50.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16N2O5 |
|---|
| Molecular Mass | 232.1059 |
|---|
| SMILES | O=C1CN(C2OC(CO)C(O)C2O)CCN1 |
|---|
| InChI Key | IVVUGGIVZUMZPF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshemiaminalshydrocarbon derivativeslactamsmonosaccharidesn-alkylpiperazinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | carbonyl grouplactammonosaccharidehemiaminalsaccharideorganic oxidepiperazinealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundprimary alcoholorganoheterocyclic compoundalcoholazacycletetrahydrofurann-alkylpiperazinecarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compound1,4-diazinanesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
