| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:49 UTC |
|---|
| Update Date | 2025-03-21 18:06:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00061792 |
|---|
| Frequency | 57.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H4F3N5O |
|---|
| Molecular Mass | 231.0368 |
|---|
| SMILES | Nc1nc2ncc(C(F)(F)F)nc2c(=O)[nH]1 |
|---|
| InChI Key | DZLLMGXDSDEHOX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganofluoridesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazinespyrimidones |
|---|
| Substituents | pterinlactamazacyclealkyl fluorideorganofluorideheteroaromatic compoundpyrimidoneorganohalogen compoundpyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundalkyl halidehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
