| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:50 UTC |
|---|
| Update Date | 2025-03-21 18:06:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00061836 |
|---|
| Frequency | 50.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H20O4 |
|---|
| Molecular Mass | 276.1362 |
|---|
| SMILES | CCCCC(=O)COC(=O)C=Cc1ccc(OC)cc1 |
|---|
| InChI Key | UTFNMNGPWLBLLB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha-acyloxy ketonesanisolesenoate estersfatty acid estershydrocarbon derivativesketonesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesphenoxy compounds |
|---|
| Substituents | fatty acylphenol ethermonocyclic benzene moietycarbonyl groupetheralpha-acyloxy ketonealkyl aryl ethercarboxylic acid derivativeketonealpha,beta-unsaturated carboxylic estercinnamic acid or derivativesorganic oxideenoate estermethoxybenzenearomatic homomonocyclic compoundfatty acid estermonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid esterhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|