DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-20 23:59:53 UTC
Update Date	2025-03-21 18:06:13 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID00061966
Frequency	50.2
Structure
Chemical Formula	C₁₃H₁₈N₂O₄
Molecular Mass	266.1267
SMILES	COC(=O)C(CO)NC(=O)C(N)Cc1ccccc1
InChI Key	RSDSJKVMUMGIEL-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	carboxylic acids and derivatives
Subclass	amino acids, peptides, and analogues
Direct Parent	peptides
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	alpha amino acid amides alpha amino acid esters alpha amino acids amphetamines and derivatives benzene and substituted derivatives beta hydroxy acids and derivatives carbonyl compounds fatty amides hydrocarbon derivatives methyl esters monoalkylamines monocarboxylic acids and derivatives n-acyl-alpha amino acids organic oxides organonitrogen compounds organopnictogen compounds phenylalanine and derivatives primary alcohols secondary carboxylic acid amides serine and derivatives
Substituents	fatty acyl monocyclic benzene moiety carbonyl group fatty amide alpha-amino acid or derivatives alpha peptide beta-hydroxy acid organic oxide methyl ester organonitrogen compound alpha-amino acid organopnictogen compound primary alcohol amphetamine or derivatives n-acyl-alpha amino acid or derivatives alcohol alpha-amino acid amide alpha-amino acid ester n-acyl-alpha-amino acid hydroxy acid carboxamide group aromatic homomonocyclic compound secondary carboxylic acid amide monocarboxylic acid or derivatives phenylalanine or derivatives organic oxygen compound carboxylic acid ester hydrocarbon derivative benzenoid primary aliphatic amine organic nitrogen compound serine or derivatives organooxygen compound

Showing information for DMID00061966