| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:55 UTC |
|---|
| Update Date | 2025-03-21 18:06:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00062030 |
|---|
| Frequency | 50.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H9ClO2 |
|---|
| Molecular Mass | 232.0291 |
|---|
| SMILES | O=C(O)c1ccccc1-c1ccc(Cl)cc1 |
|---|
| InChI Key | LCDIWTLDJLGFKG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | biphenyls and derivatives |
|---|
| Direct Parent | chlorinated biphenyls |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsaryl chloridesbenzoic acidsbenzoyl derivativeschlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesorganooxygen compounds |
|---|
| Substituents | aryl chloridechlorobenzenecarboxylic acidorganochloridebenzoylbenzoic acid or derivativescarboxylic acid derivativeorganohalogen compoundaryl halidearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivative1-carboxy-2-haloaromatic compoundhalobenzenebenzoic acidchlorinated biphenylorganooxygen compound |
|---|