| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:59:57 UTC |
|---|
| Update Date | 2025-03-21 18:06:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00062115 |
|---|
| Frequency | 50.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H19NO6P+ |
|---|
| Molecular Mass | 256.0944 |
|---|
| SMILES | C[N+](C)(C)CCOP(=O)(O)OCC(=O)CO |
|---|
| InChI Key | DLUPCWDUTRNRQU-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | quaternary ammonium salts |
|---|
| Direct Parent | phosphocholines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalpha-hydroxy ketonesaminesdialkyl phosphatesglycerone and derivativeshydrocarbon derivativesmonosaccharidesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupmonosaccharidealpha-hydroxy ketoneketonesaccharideorganic oxideglycerone or derivativesorganopnictogen compoundorganic cationorganic saltalcoholtetraalkylammonium saltphosphocholinedialkyl phosphateorganic oxygen compoundphosphoric acid esterhydrocarbon derivativeorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
