| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:00:02 UTC |
|---|
| Update Date | 2025-03-21 18:06:17 UTC |
|---|
| HMDB ID | HMDB0134087 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00062297 |
|---|
| Name | 3-[2-hydroxy-3-(sulfooxy)phenyl]prop-2-enoic acid |
|---|
| Frequency | 49.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8O7S |
|---|
| Molecular Mass | 259.9991 |
|---|
| SMILES | O=C(O)C=Cc1cccc(OS(=O)(=O)O)c1O |
|---|
| InChI Key | FPJAIOYEOVSHLH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-4-unsubstituted benzenoidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenylsulfatessulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupsulfuric acid monoestercarboxylic acidorganic sulfuric acid or derivatives1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativehydroxycinnamic acidaromatic homomonocyclic compoundphenylsulfateorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsulfate-esterphenolhydrocarbon derivativearylsulfatebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
