| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:06 UTC |
|---|
| Update Date | 2025-03-21 18:06:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00062409 |
|---|
| Frequency | 49.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N2O6 |
|---|
| Molecular Mass | 260.1008 |
|---|
| SMILES | OCC(O)c1cn(C2OC(CO)C(O)C2O)cn1 |
|---|
| InChI Key | MUEPFMSUNZADAV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | imidazole ribonucleosides and ribonucleotides |
|---|
| Subclass | imidazole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | imidazole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | aromatic alcoholalcoholimidazole ribonucleosidearomatic heteromonocyclic compoundazacycletetrahydrofuranheteroaromatic compoundmonosaccharideoxacyclesaccharideorganic oxygen compoundimidazoleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholorganoheterocyclic compoundorganooxygen compoundazolen-substituted imidazole |
|---|