| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:09 UTC |
|---|
| Update Date | 2025-03-21 18:06:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00062527 |
|---|
| Frequency | 49.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N5O8P |
|---|
| Molecular Mass | 349.0423 |
|---|
| SMILES | Nc1nc2c(ncn2C2OC(O)C(OP(=O)(O)O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | XZOOGKOOWRMJNX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | ribonucleoside 3'-phosphates |
|---|
| Subclass | ribonucleoside 3'-phosphates |
|---|
| Direct Parent | ribonucleoside 3'-phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundshemiacetalsheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmonoalkyl phosphatesmonosaccharidesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativespyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | lactammonosaccharidepyrimidoneimidazopyrimidinepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhemiacetalorganoheterocyclic compoundazolen-substituted imidazoleribonucleoside 3'-phosphatealcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhypoxanthinehydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
