| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:09 UTC |
|---|
| Update Date | 2025-03-21 18:06:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00062540 |
|---|
| Frequency | 49.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H19N2O11P |
|---|
| Molecular Mass | 410.0726 |
|---|
| SMILES | O=c1ccn(C2OC(COP3(=O)OC(CO)C(O)C3O)C(O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | RUNXQHLRDKKAGU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl alkylphosphonatesheteroaromatic compoundshydrocarbon derivativeslactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxaphospholanesphosphacyclic compoundsphosphonic acid estersprimary alcoholssecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | dialkyl alkylphosphonatelactamaromatic heteromonocyclic compoundmonosaccharidepyrimidonephosphacyclephosphonic acid ester1,2_oxaphospholanesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholorganophosphonic acid derivativealcoholvinylogous amidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundphosphonic acid diesteroxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
