| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:10 UTC |
|---|
| Update Date | 2025-03-21 18:06:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00062560 |
|---|
| Frequency | 49.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H8O4 |
|---|
| Molecular Mass | 204.0423 |
|---|
| SMILES | CC(=O)Oc1ccc2ccc(=O)oc2c1 |
|---|
| InChI Key | MGZOXZPZHVOXQB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarins and derivatives |
|---|
| Direct Parent | coumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransbenzenoidscarbonyl compoundscarboxylic acid estersheteroaromatic compoundshydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | carbonyl groupbenzopyran1-benzopyranheteroaromatic compoundcarboxylic acid derivativecoumarinlactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundpyrancarboxylic acid esterpyranonehydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
