| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:16 UTC |
|---|
| Update Date | 2025-03-21 18:06:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00062799 |
|---|
| Frequency | 49.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16N2O4 |
|---|
| Molecular Mass | 216.111 |
|---|
| SMILES | NC(CO)C(=O)N1CCCC(C(=O)O)C1 |
|---|
| InChI Key | SOTIVMKHLNIDJK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acylpiperidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinecarboxylic acidsprimary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcarboxylic acidorganic oxidetertiary carboxylic acid amidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundpiperidinecarboxylic acidpiperidineprimary alcoholorganoheterocyclic compoundalcoholalpha-amino acid amideazacyclecarboxamide groupn-acyl-piperidinemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
