| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:00:19 UTC |
|---|
| Update Date | 2025-03-21 18:06:23 UTC |
|---|
| HMDB ID | HMDB0013680 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00062909 |
|---|
| Name | Caftaric acid |
|---|
| Frequency | 49.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12O9 |
|---|
| Molecular Mass | 312.0481 |
|---|
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OC(C(=O)O)C(O)C(=O)O |
|---|
| InChI Key | SWGKAHCIOQPKFW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalpha hydroxy acids and derivativesbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsenoate estersfatty acid estershydrocarbon derivativesmonosaccharidesorganic oxidessecondary alcoholstricarboxylic acids and derivatives |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidalpha-hydroxy acid1-hydroxy-2-unsubstituted benzenoidmonosaccharidetricarboxylic acid or derivativescarboxylic acid derivativealpha,beta-unsaturated carboxylic esterbeta-hydroxy acidsaccharideorganic oxideenoate esteralcoholhydroxy acid1-hydroxy-4-unsubstituted benzenoidhydroxycinnamic acidaromatic homomonocyclic compoundfatty acid esterorganic oxygen compoundcarboxylic acid estersecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
