| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:20 UTC |
|---|
| Update Date | 2025-03-21 18:06:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00062939 |
|---|
| Frequency | 49.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14N2O6 |
|---|
| Molecular Mass | 246.0852 |
|---|
| SMILES | O=C1CN(C2OC(CO)C(O)C2O)CC(=O)N1 |
|---|
| InChI Key | GYPUCSKMGILPBB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdicarboximidesdioxopiperazineshemiaminalshydrocarbon derivativesmonosaccharidesn-alkylpiperazinesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl groupmonosaccharidehemiaminalcarboxylic acid imide, n-unsubstitutedsaccharideorganic oxidedioxopiperazinepiperazinealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximideprimary alcoholorganoheterocyclic compoundalcoholazacycletetrahydrofurann-alkylpiperazinecarboxylic acid imideoxacycleorganic oxygen compound1,4-diazinanesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
