| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:22 UTC |
|---|
| Update Date | 2025-03-21 18:06:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063013 |
|---|
| Frequency | 49.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15NO6 |
|---|
| Molecular Mass | 269.0899 |
|---|
| SMILES | O=C(O)c1ccc(NC2OC(CO)C(O)C2O)cc1 |
|---|
| InChI Key | QNUBRHYSSHJWDH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenylalkylaminesprimary alcoholssecondary alcoholssecondary alkylarylaminestetrahydrofurans |
|---|
| Substituents | carboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acidbenzoylmonosaccharidecarboxylic acid derivativesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundbenzoic acidprimary alcoholorganoheterocyclic compoundalcoholtetrahydrofuransecondary aminesecondary aliphatic/aromatic amineoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholphenylalkylaminehydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|
