| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:24 UTC |
|---|
| Update Date | 2025-03-21 18:06:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063079 |
|---|
| Frequency | 49.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12N2O6 |
|---|
| Molecular Mass | 268.0695 |
|---|
| SMILES | O=C(O)CC(NC(=O)Nc1ccc(O)cc1)C(=O)O |
|---|
| InChI Key | NLCLHTFWJZSXLH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | aspartic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesn-carbamoyl-alpha amino acidsn-phenylureasorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarbonic acid derivativecarboxylic acidn-carbamoyl-alpha-amino acid1-hydroxy-2-unsubstituted benzenoidaromatic homomonocyclic compoundn-phenylureaorganic oxideorganic oxygen compoundn-carbamoyl-alpha-amino acid or derivativesaspartic acid or derivativesorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|