| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:29 UTC |
|---|
| Update Date | 2025-03-21 18:06:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063290 |
|---|
| Frequency | 48.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13NO5 |
|---|
| Molecular Mass | 191.0794 |
|---|
| SMILES | NC(=O)C1(O)CC(O)C(O)C(O)C1 |
|---|
| InChI Key | UUXNGIBKHRVAEP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativescyclitols and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidestertiary alcohols |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupcyclohexanolcyclitol or derivativescyclic alcoholcarboxamide groupcarboxylic acid derivativetertiary alcoholorganic oxideorganonitrogen compoundaliphatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound |
|---|
