| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:30 UTC |
|---|
| Update Date | 2025-03-21 18:06:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063311 |
|---|
| Frequency | 48.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12N2O2 |
|---|
| Molecular Mass | 240.0899 |
|---|
| SMILES | O=C(O)CCc1nccc2c1[nH]c1ccccc12 |
|---|
| InChI Key | CNUHEVWYPKFJHH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | harmala alkaloids |
|---|
| Subclass | harmala alkaloids |
|---|
| Direct Parent | harmala alkaloids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesazacyclic compoundsbenzenoidsbeta carbolinescarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesindolesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinespyrroles |
|---|
| Substituents | carbonyl groupcarboxylic acidindolepolyhalopyridinecarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound2-halopyridineorganoheterocyclic compoundazacycleheteroaromatic compoundhydroxypyridineharmanindole or derivativesmonocarboxylic acid or derivativespyridineorganic oxygen compoundpyrrolebeta-carbolinehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundpyridoindole |
|---|
