| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:30 UTC |
|---|
| Update Date | 2025-03-21 18:06:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063321 |
|---|
| Frequency | 48.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H14O9 |
|---|
| Molecular Mass | 326.0638 |
|---|
| SMILES | O=C1c2ccccc2OC1OC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | DSRHEOKQPNYFGX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsaryl alkyl ketonesbenzenoidsbenzofuranonesbeta hydroxy acids and derivativescarboxylic acidscoumaransglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidaryl alkyl ketonebenzofuranoneo-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acidketone1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundoxaneorganoheterocyclic compoundcoumaranalcoholpyran carboxylic acid or derivativesbenzofuranhydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativebenzenoidaryl ketone |
|---|
