| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:33 UTC |
|---|
| Update Date | 2025-03-21 18:06:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063461 |
|---|
| Frequency | 48.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N2O7 |
|---|
| Molecular Mass | 276.0958 |
|---|
| SMILES | O=C1CCN(C2OC(C(O)CO)C(O)C2O)C(=O)N1 |
|---|
| InChI Key | BMKPKGKKBIPKPL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdiazinanesdicarboximideshydrocarbon derivativesmonosaccharidesn-acyl ureasorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl groupmonosaccharidepyrimidonecarboxylic acid derivative1,3-diazinanesaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compounddicarboximideprimary alcoholureidealcoholn-acyl ureacarbonic acid derivativeazacycletetrahydrofuranoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|