| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:36 UTC |
|---|
| Update Date | 2025-03-21 18:06:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063562 |
|---|
| Frequency | 48.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19N4O2S+ |
|---|
| Molecular Mass | 307.1223 |
|---|
| SMILES | Cc1ncc(C[n+]2csc(CCCC(=O)O)c2C)c(N)n1 |
|---|
| InChI Key | ULXKYDMBSIJSAF-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | thiamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 4,5-disubstituted thiazolesamino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganopnictogen compoundsprimary amines |
|---|
| Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acidcarboxylic acid derivativeorganic oxidethiamineorganonitrogen compoundorganopnictogen compoundorganic cationimidolactamazoleazacycleheteroaromatic compound4,5-disubstituted 1,3-thiazolemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundthiazoleamineorganooxygen compound |
|---|