| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:00:36 UTC |
|---|
| Update Date | 2025-03-21 18:06:32 UTC |
|---|
| HMDB ID | HMDB0135289 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063589 |
|---|
| Name | {4-[(1E)-3-oxoprop-1-en-1-yl]phenyl}oxidanesulfonic acid |
|---|
| Frequency | 48.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8O5S |
|---|
| Molecular Mass | 228.0092 |
|---|
| SMILES | O=CC=Cc1ccc(OS(=O)(=O)O)cc1 |
|---|
| InChI Key | HMTMVRYLYCEPCW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aldehydescinnamaldehydeshydrocarbon derivativesorganic oxidesphenoxy compoundssulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietycinnamaldehydecarbonyl groupsulfuric acid monoesteraldehydearomatic homomonocyclic compoundphenylsulfateorganic oxideorganic oxygen compoundsulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
