| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:38 UTC |
|---|
| Update Date | 2025-03-21 18:06:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063662 |
|---|
| Frequency | 48.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16O11 |
|---|
| Molecular Mass | 312.0693 |
|---|
| SMILES | O=C(O)C1OC(O)C(O)C(O)C1OC1OC(O)C(O)C1O |
|---|
| InChI Key | AUCPEODDUZBXAY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acidshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidpyran carboxylic acid or derivativesglucuronic acid or derivativestetrahydrofuranmonosaccharidecarboxylic acid derivativepyran carboxylic acidoxacycleorganic oxidemonocarboxylic acid or derivativesacetalpyranaliphatic heteromonocyclic compoundsecondary alcoholhemiacetalhydrocarbon derivativeoxaneorganoheterocyclic compound |
|---|