| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:00:38 UTC |
|---|
| Update Date | 2025-03-21 18:06:32 UTC |
|---|
| HMDB ID | HMDB0259234 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063665 |
|---|
| Name | Trimesic acid |
|---|
| Frequency | 48.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H6O6 |
|---|
| Molecular Mass | 210.0164 |
|---|
| SMILES | O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1 |
|---|
| InChI Key | QMKYBPDZANOJGF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidbenzoylbenzoic acid or derivativestricarboxylic acid or derivativesaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundhydrocarbon derivativebenzenoidbenzoic acidorganooxygen compound |
|---|
