| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:42 UTC |
|---|
| Update Date | 2025-03-21 18:06:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063805 |
|---|
| Frequency | 48.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10O3 |
|---|
| Molecular Mass | 226.063 |
|---|
| SMILES | Oc1ccc2c(ccc3cc(O)cc(O)c32)c1 |
|---|
| InChI Key | OXIZOSQNTRMKOF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrols |
|---|
| Direct Parent | phenanthrols |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidshydrocarbon derivativesnaphthols and derivativesorganooxygen compounds |
|---|
| Substituents | phenanthrol1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compound1-hydroxy-4-unsubstituted benzenoidnaphthaleneorganic oxygen compoundhydrocarbon derivative1-naphthol2-naphtholorganooxygen compound |
|---|