| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:00:42 UTC |
|---|
| Update Date | 2025-03-21 18:06:34 UTC |
|---|
| HMDB ID | HMDB0251168 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063822 |
|---|
| Name | Dibenzyl phthalate |
|---|
| Frequency | 48.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H18O4 |
|---|
| Molecular Mass | 346.1205 |
|---|
| SMILES | O=C(OCc1ccccc1)c1ccccc1C(=O)OCc1ccccc1 |
|---|
| InChI Key | UCVPKAZCQPRWAY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acid esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoyl derivativesbenzyloxycarbonylscarboxylic acid estersdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | benzyloxycarbonylbenzoylbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid esterdicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|