| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:43 UTC |
|---|
| Update Date | 2025-03-21 18:06:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063839 |
|---|
| Frequency | 48.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18O2 |
|---|
| Molecular Mass | 254.1307 |
|---|
| SMILES | CC(C(=O)O)c1ccc(C(C)c2ccccc2)cc1 |
|---|
| InChI Key | TWJPLFYRCOSUBW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aromatic monoterpenoidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxidesphenylpropanoic acids |
|---|
| Substituents | diphenylmethanemonoterpenoidcarbonyl groupmonocyclic monoterpenoidcarboxylic acidp-cymenecarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound2-phenylpropanoic-acidhydrocarbon derivativeorganooxygen compoundaromatic monoterpenoid |
|---|