| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:44 UTC |
|---|
| Update Date | 2025-03-21 18:06:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063886 |
|---|
| Frequency | 57.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H17N5O5 |
|---|
| Molecular Mass | 287.123 |
|---|
| SMILES | Nc1nc(=O)c2c([nH]1)NCC(C(O)C(O)C(O)CO)N2 |
|---|
| InChI Key | REUPCXLDUALIKH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsprimary alcoholsprimary aminespyrimidonessecondary alcoholssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | monosaccharidepyrimidonepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholalcoholvinylogous amidepterinazacycleheteroaromatic compoundsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|