| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:47 UTC |
|---|
| Update Date | 2025-03-21 18:06:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00063998 |
|---|
| Frequency | 48.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H7N5O3 |
|---|
| Molecular Mass | 221.0549 |
|---|
| SMILES | COC(=O)c1cnc2nc(N)[nH]c(=O)c2n1 |
|---|
| InChI Key | HCLJNHIVCKKQNR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterin carboxylates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmethyl estersmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazine carboxylic acidspyrimidones |
|---|
| Substituents | lactamamino acid or derivativespyrimidonecarboxylic acid derivativepyrimidineorganic oxidemethyl esteraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundazacycleheteroaromatic compoundpterin-6-carboxylatemonocarboxylic acid or derivativesorganic oxygen compoundpyrazinecarboxylic acid esterpyrazine carboxylic acidpyrazine carboxylic acid or derivativeshydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
