| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:00:48 UTC |
|---|
| Update Date | 2025-03-21 18:06:36 UTC |
|---|
| HMDB ID | HMDB0247930 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00064041 |
|---|
| Name | 6-Acetylcodeine |
|---|
| Frequency | 48.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H23NO4 |
|---|
| Molecular Mass | 341.1627 |
|---|
| SMILES | COc1ccc2c3c1OC1C(OC(C)=O)C=CC4C(C2)N(C)CCC341 |
|---|
| InChI Key | MFXFQKMUCYHPFQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersamino acids and derivativesanisolesazacyclic compoundscarbonyl compoundscarboxylic acid esterscoumaranshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenanthrenes and derivativespiperidinestetralinstrialkylamines |
|---|
| Substituents | tetralinphenol ethercarbonyl groupetheramino acid or derivativesalkyl aryl ethercarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundcoumaranphenanthreneazacycletertiary aliphatic amineoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|
