| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:48 UTC |
|---|
| Update Date | 2025-03-21 18:06:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00064053 |
|---|
| Frequency | 48.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16O10 |
|---|
| Molecular Mass | 356.0743 |
|---|
| SMILES | COc1cc(C=CC(=O)O)ccc1OC1OOC(C(=O)O)C(O)C1O |
|---|
| InChI Key | SMBGLVCCFFCXQD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diols1,2-dioxanesalkyl aryl ethersanisolesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl peroxidesdicarboxylic acids and derivativeshydrocarbon derivativesmethoxybenzenesorganic oxidesoxacyclic compoundsphenoxy compoundssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundalkyl aryl ethercarboxylic acid derivativecinnamic acid or derivativesbeta-hydroxy acidorganic oxidedialkyl peroxideorganoheterocyclic compound1,2-diolalcoholhydroxy acidmethoxybenzeneoxacycleorganic oxygen compoundanisolesecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidphenoxy compoundortho-dioxaneorganooxygen compound |
|---|
