| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:52 UTC |
|---|
| Update Date | 2025-03-21 18:06:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00064193 |
|---|
| Frequency | 47.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H19NO3PS+ |
|---|
| Molecular Mass | 228.0818 |
|---|
| SMILES | CCOP(O)(=S)OCC[N+](C)(C)C |
|---|
| InChI Key | WFEMUZIHVFEFEX-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic thiophosphoric acids and derivatives |
|---|
| Subclass | thiophosphoric acid esters |
|---|
| Direct Parent | thiophosphate diesters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | amineshydrocarbon derivativesorganic cationsorganic saltsorganooxygen compoundsorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundtetraalkylammonium saltquaternary ammonium saltthiophosphate diesterorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamineorganooxygen compound |
|---|