| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:52 UTC |
|---|
| Update Date | 2025-03-21 18:06:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00064199 |
|---|
| Frequency | 47.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16N4O4 |
|---|
| Molecular Mass | 256.1172 |
|---|
| SMILES | CC(O)C(O)C1CNc2c(n(C)c(=O)[nH]c2=O)N1 |
|---|
| InChI Key | HUINKOIIJREHCF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundssecondary alcoholssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | alcoholvinylogous amidecarbonic acid derivativelactamazacycleheteroaromatic compoundpyrimidonesecondary aminesecondary aliphatic/aromatic amineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound1,2-diol |
|---|