| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:53 UTC |
|---|
| Update Date | 2025-03-21 18:06:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00064245 |
|---|
| Frequency | 47.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8NO5P |
|---|
| Molecular Mass | 241.014 |
|---|
| SMILES | O=P(O)(O)Oc1cccc2ccc(O)nc12 |
|---|
| InChI Key | DAGYZBXUKLJHJS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | quinolones and derivatives |
|---|
| Direct Parent | quinolones and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaryl phosphomonoestersazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridines |
|---|
| Substituents | quinoloneazacyclepolyhalopyridineheteroaromatic compoundhydroxypyridineorganic oxidepyridineorganic oxygen compoundphosphoric acid esteraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativearyl phosphomonoesterbenzenoid2-halopyridineorganic nitrogen compoundaryl phosphateorganic phosphoric acid derivativeorganooxygen compound |
|---|
