| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:56 UTC |
|---|
| Update Date | 2025-03-21 18:06:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00064352 |
|---|
| Frequency | 47.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8O7S |
|---|
| Molecular Mass | 259.9991 |
|---|
| SMILES | O=C(CC(=O)c1ccc(O)cc1)OS(=O)(=O)O |
|---|
| InChI Key | DPVAZUCZWRUITN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl alkyl ketonesbenzoyl derivativesbeta-keto acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoesterorganic sulfuric acid or derivativesaryl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativebeta-keto acidaromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesketo acidphenolhydrocarbon derivativebenzenoidsulfuric acid esteralkyl-phenylketone |
|---|
