| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:00:58 UTC |
|---|
| Update Date | 2025-03-21 18:06:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00064462 |
|---|
| Frequency | 47.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7NO6S |
|---|
| Molecular Mass | 232.9994 |
|---|
| SMILES | O=C(O)c1cc(NS(=O)(=O)O)ccc1O |
|---|
| InChI Key | DNZBAWJLMIMBCF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | sulfanilides |
|---|
| Direct Parent | sulfanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoidsbenzoic acidsbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundssalicylic acidssulfuric acid monoamidesvinylogous acids |
|---|
| Substituents | carboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidorganic sulfuric acid or derivativesbenzoic acid or derivativeshydroxybenzoic acidaromatic homomonocyclic compoundsulfanilidevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativessulfuric acid monoamidephenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
