| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:00 UTC |
|---|
| Update Date | 2025-03-21 18:06:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00064516 |
|---|
| Frequency | 47.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19NO3 |
|---|
| Molecular Mass | 285.1365 |
|---|
| SMILES | CN1CCC23c4c5ccc(O)c4CC1C2C=CC(O)C3O5 |
|---|
| InChI Key | XJZYXVSASPQAKD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersazacyclic compoundscoumaranshydrocarbon derivativesorganopnictogen compoundsoxacyclic compoundsphenanthrenes and derivativespiperidinessecondary alcoholstetralinstrialkylamines |
|---|
| Substituents | tetralinether1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundcoumaranalcoholphenanthreneazacycletertiary aliphatic amineoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|
