| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:10 UTC |
|---|
| Update Date | 2025-03-21 18:06:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00064911 |
|---|
| Frequency | 47.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14N2O3S |
|---|
| Molecular Mass | 230.0725 |
|---|
| SMILES | O=C(O)CCC1CC2NC(=O)NC2CS1 |
|---|
| InChI Key | WDBNVVQWVDJARP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | thia fatty acids |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidsdialkylthioethersfatty acylshydrocarbon derivativesimidazolidinonesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsthianes |
|---|
| Substituents | imidazolidinecarbonyl groupcarbonic acid derivativecarboxylic acidazacycledialkylthioethercarboxylic acid derivativealiphatic heteropolycyclic compoundimidazolidinoneorganic oxidemonocarboxylic acid or derivativesthia fatty acidorganic oxygen compoundthioetherorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compoundthiane |
|---|