| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:10 UTC |
|---|
| Update Date | 2025-03-21 18:06:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00064934 |
|---|
| Frequency | 47.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H11N6O+ |
|---|
| Molecular Mass | 255.0989 |
|---|
| SMILES | Nc1nc(N)c2[o+]c(-c3ccccc3)c(N)nc2n1 |
|---|
| InChI Key | HOGIKOQGOOOXDQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic cationsorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsprimary amines |
|---|
| Substituents | monocyclic benzene moietyazacycleheteroaromatic compoundpyrimidineoxacycleorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundorganic cationimidolactamamineorganooxygen compound |
|---|
