| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:10 UTC |
|---|
| Update Date | 2025-03-21 18:06:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00064942 |
|---|
| Frequency | 47.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H29N3O17P2 |
|---|
| Molecular Mass | 621.0972 |
|---|
| SMILES | COC1C(O)C(COP(=O)(O)OP(=O)(O)OC2OC(CO)C(O)C(O)C2NC(C)=O)OC1n1ccc(=O)[nH]c1=O |
|---|
| InChI Key | LRSMXALRUABKNE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkyl ethersheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesn-acyl-alpha-hexosaminesorganic carbonic acids and derivativesorganic oxidesorganic pyrophosphatesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespentose phosphatesprimary alcoholspyrimidine ribonucleoside diphosphatespyrimidonessecondary alcoholssecondary carboxylic acid amidestetrahydrofuransvinylogous amides |
|---|
| Substituents | carbonyl groupetherlactamaromatic heteromonocyclic compoundpentose phosphatemonosaccharidepentose-5-phosphatepyrimidonecarboxylic acid derivativedialkyl etherpyrimidinen-acyl-alpha-hexosamineorganic oxideorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholvinylogous amidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundcarboxamide grouporganic pyrophosphateoxacyclesecondary carboxylic acid amidepyrimidine ribonucleoside diphosphatephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|