| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:01:13 UTC |
|---|
| Update Date | 2025-03-21 18:06:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00065035 |
|---|
| Frequency | 47.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13O9P |
|---|
| Molecular Mass | 260.0297 |
|---|
| SMILES | O=C(OCC(O)CO)C(O)COP(=O)(O)O |
|---|
| InChI Key | HWJPNUNQKPWPMT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | glycerolipids |
|---|
| Subclass | monoradylglycerols |
|---|
| Direct Parent | 1-monoacylglycerols |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersglycerolipidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesprimary alcoholssecondary alcoholssugar acids and derivatives |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupmonosaccharide1-acyl-sn-glycerolcarboxylic acid derivativesaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid esterglyceric_acidmonoalkyl phosphatecarboxylic acid estersecondary alcoholhydrocarbon derivativeprimary alcoholorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|